Difference between revisions of "CPD-16618"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008626001_1 == * Synonym(s): == Reactions associated == * 5.3.4.1-RXN ** pantograph-galdieria.sulphuraria * DISULISOM-RXN **...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == |
+ | * smiles: | ||
+ | ** C(C(=O)[O-])C(O)[CH]=O | ||
+ | * molecular weight: | ||
+ | ** 117.081 | ||
+ | * inchi key: | ||
+ | ** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M | ||
+ | * common name: | ||
+ | ** L-malic semialdehyde | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (3R)-3-hydroxy-4-oxobutanoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-6002]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049] | ||
+ | {{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}} | ||
+ | {{#set: molecular weight=117.081 }} | ||
+ | {{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}} | ||
+ | {{#set: common name=L-malic semialdehyde}} | ||
+ | {{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}} | ||
+ | {{#set: consumed by=RXN-6002}} |
Latest revision as of 17:36, 9 January 2019
Contents
Metabolite CPD-16618
- smiles:
- C(C(=O)[O-])C(O)[CH]=O
- molecular weight:
- 117.081
- inchi key:
- InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
- common name:
- L-malic semialdehyde
- Synonym(s):
- (3R)-3-hydroxy-4-oxobutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.