Difference between revisions of "CPD-16618"

Latest revision as of 18:36, 9 January 2019

"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene CHC_T00008626001_1 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
+* smiles:
+** C(C(=O)[O-])C(O)[CH]=O
+* molecular weight:
+** 117.081
+* inchi key:
+** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
+* common name:
+** L-malic semialdehyde
 * Synonym(s):
+** (3R)-3-hydroxy-4-oxobutanoate
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[5.3.4.1-RXN]]
+* [[RXN-6002]]
-** [[pantograph]]-[[galdieria.sulphuraria]]
+== Reaction(s) known to produce the compound ==
-* [[DISULISOM-RXN]]
+== Reaction(s) of unknown directionality ==
-** [[pantograph]]-[[galdieria.sulphuraria]]
-== Pathways associated ==
 == External links  ==
-{{#set: reaction associated=5.3.4.1-RXN|DISULISOM-RXN}}
+* PUBCHEM:
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
+{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
+{{#set: molecular weight=117.081    }}
+{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
+{{#set: common name=L-malic semialdehyde}}
+{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+{{#set: consumed by=RXN-6002}}