Difference between revisions of "VALINE--TRNA-LIGASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=VALINE--TRNA-LIGASE-RXN VALINE--TRNA-LIGASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/6.1.1.9 EC-6.1.1.9] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[VAL]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[VAL-tRNAs]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[Charged-VAL-tRNAs]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 L-valine[c] '''+''' 1 ATP[c] '''+''' 1 a tRNAval[c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 an L-valyl-[tRNAval][c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00005897001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00001234001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | ||
+ | ** '''21''' reactions found over '''21''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10704 10704] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P28350 P28350] |
− | * | + | ** [http://www.uniprot.org/uniprot/P36420 P36420] |
− | * | + | ** [http://www.uniprot.org/uniprot/P56000 P56000] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O51680 O51680] |
− | * | + | ** [http://www.uniprot.org/uniprot/O67411 O67411] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O83998 O83998] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9ZCN6 Q9ZCN6] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9Z987 Q9Z987] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9X2D7 Q9X2D7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9ZK61 Q9ZK61] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CDP6 Q9CDP6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q58413 Q58413] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43834 P43834] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PPE4 Q9PPE4] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O84304 O84304] |
+ | ** [http://www.uniprot.org/uniprot/P47576 P47576] | ||
+ | ** [http://www.uniprot.org/uniprot/Q94678 Q94678] | ||
+ | ** [http://www.uniprot.org/uniprot/Q04462 Q04462] | ||
+ | ** [http://www.uniprot.org/uniprot/P26640 P26640] | ||
+ | ** [http://www.uniprot.org/uniprot/Q05873 Q05873] | ||
+ | ** [http://www.uniprot.org/uniprot/Q26177 Q26177] | ||
+ | ** [http://www.uniprot.org/uniprot/P75304 P75304] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49021 Q49021] | ||
+ | ** [http://www.uniprot.org/uniprot/P11931 P11931] | ||
+ | ** [http://www.uniprot.org/uniprot/P07806 P07806] | ||
+ | ** [http://www.uniprot.org/uniprot/P07118 P07118] | ||
+ | ** [http://www.uniprot.org/uniprot/O77443 O77443] | ||
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R03665 R03665] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-6.1.1.9}} | ||
+ | {{#set: gene associated=CHC_T00005897001_1|CHC_T00001234001_1}} | ||
+ | {{#set: in pathway=TRNA-CHARGING-PWY}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 17:36, 9 January 2019
Contents
Reaction VALINE--TRNA-LIGASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 L-valine[c] + 1 ATP[c] + 1 a tRNAval[c] => 1 diphosphate[c] + 1 AMP[c] + 1 an L-valyl-[tRNAval][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00005897001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00001234001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
- TRNA-CHARGING-PWY, tRNA charging: TRNA-CHARGING-PWY
- 21 reactions found over 21 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links
- RHEA:
- UNIPROT:
- LIGAND-RXN: