Difference between revisions of "CHC T00009258001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE GLUTATHIONE] == * smiles: ** C(S)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inch...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009258001 == |
− | * | + | * left end position: |
− | ** | + | ** 61046 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 61681 |
− | * | + | * centisome position: |
− | ** | + | ** 44.60601 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CDPKIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | * [[RXN- | + | * Reaction: [[DADPKIN-RXN]] |
− | * [[RXN- | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[DCDPKIN-RXN]] |
− | * [[RXN- | + | ** Source: [[annotation-original_genome]] |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[DGDPKIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[DTDPKIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | * Reaction: [[DUDPKIN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
+ | * Reaction: [[GDPKIN-RXN]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[NUCLEOSIDE-DIP-KIN-RXN]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-14120]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-14228]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[UDPKIN-RXN]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-166]] | ||
+ | * [[PWY-7197]] | ||
+ | * [[PPGPPMET-PWY]] | ||
+ | * [[PWY-7205]] | ||
+ | * [[PWY-7224]] | ||
+ | * [[PWY-7220]] | ||
+ | * [[PWY-7210]] | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7176]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7221]] | ||
+ | * [[PWY-7226]] | ||
+ | * [[PWY-7227]] | ||
+ | * [[PWY-7187]] | ||
+ | * [[PWY-7222]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=61046}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=61681}} | |
− | + | {{#set: centisome position=44.60601 }} | |
− | + | {{#set: reaction associated=CDPKIN-RXN|DADPKIN-RXN|DCDPKIN-RXN|DGDPKIN-RXN|DTDPKIN-RXN|DUDPKIN-RXN|GDPKIN-RXN|NUCLEOSIDE-DIP-KIN-RXN|RXN-14120|RXN-14228|UDPKIN-RXN}} | |
− | + | {{#set: pathway associated=PWY0-166|PWY-7197|PPGPPMET-PWY|PWY-7205|PWY-7224|PWY-7220|PWY-7210|PWY-7184|PWY-7176|PWY-7198|PWY-6545|PWY-7221|PWY-7226|PWY-7227|PWY-7187|PWY-7222}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 17:37, 9 January 2019
Gene CHC_T00009258001
- left end position:
- 61046
- transcription direction:
- NEGATIVE
- right end position:
- 61681
- centisome position:
- 44.60601
- Synonym(s):
Reactions associated
- Reaction: CDPKIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: DADPKIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: DCDPKIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: DGDPKIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: DTDPKIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: DUDPKIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: GDPKIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: NUCLEOSIDE-DIP-KIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-14120
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-14228
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: UDPKIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
Pathways associated
- PWY0-166
- PWY-7197
- PPGPPMET-PWY
- PWY-7205
- PWY-7224
- PWY-7220
- PWY-7210
- PWY-7184
- PWY-7176
- PWY-7198
- PWY-6545
- PWY-7221
- PWY-7226
- PWY-7227
- PWY-7187
- PWY-7222