Difference between revisions of "CHC T00009326001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * inchi key: ** InChIKey=NJMGRJ...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009326001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[HOMOCYSMET-RXN]] | |
− | == | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | ** Source: [[orthology-arabidopsis_thaliana]] |
+ | * Reaction: [[RXN-12730]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-702]] | ||
+ | * [[HSERMETANA-PWY]] | ||
+ | * [[HOMOSER-METSYN-PWY]] | ||
+ | * [[PWY-5041]] | ||
+ | * [[PWY-6936]] | ||
+ | * [[PWY-6151]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=HOMOCYSMET-RXN|RXN-12730}} | |
− | + | {{#set: pathway associated=PWY-702|HSERMETANA-PWY|HOMOSER-METSYN-PWY|PWY-5041|PWY-6936|PWY-6151}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 18:37, 9 January 2019
Gene CHC_T00009326001_1
- Synonym(s):
Reactions associated
- Reaction: HOMOCYSMET-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Reaction: RXN-12730
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus