|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETOLACTSYN-RXN ACETOLACTSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14779 CPD-14779] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(O)C1(OC(C(C(C1O)O)O)=O) |
| + | * molecular weight: |
| + | ** 178.141 |
| + | * inchi key: |
| + | ** InChIKey=PHOQVHQSTUBQQK-MGCNEYSASA-N |
| * common name: | | * common name: |
− | ** acetolactate synthase small subunit | + | ** D-galactono-1,5-lactone |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/2.2.1.6 EC-2.2.1.6]
| + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** D-galactonolactone |
| + | ** D-galactonic acid δ-lactone |
| + | ** D-galactono-8-lactone |
| + | ** (3R,4S,5R,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 2 [[PYRUVATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[2-ACETO-LACTATE]][c]
| + | * [[RXN-13740]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 2 pyruvate[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 (S)-2-acetolactate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_980]]
| + | |
− | ** ORIGINAL_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[CHC_T00002409001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00008160001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | == Pathways == | + | |
− | * [[VALSYN-PWY]], L-valine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=VALSYN-PWY VALSYN-PWY]
| + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7111]], pyruvate fermentation to isobutanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7111 PWY-7111]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6389]], (S)-acetoin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6389 PWY-6389]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5938]], (R)-acetoin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5938 PWY-5938]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5939]], (R)-acetoin biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5939 PWY-5939] | + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[original_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20504 20504] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15945 15945] |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25249 25249] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439781 439781] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00226 R00226] | + | * LIGAND-CPD: |
− | * UNIPROT: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02669 C02669] |
− | ** [http://www.uniprot.org/uniprot/Q59950 Q59950] | + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/P42463 P42463]
| + | ** [http://www.chemspider.com/Chemical-Structure.388836.html 388836] |
− | ** [http://www.uniprot.org/uniprot/Q8XAV3 Q8XAV3]
| + | {{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}} |
− | ** [http://www.uniprot.org/uniprot/P27868 P27868]
| + | {{#set: molecular weight=178.141 }} |
− | ** [http://www.uniprot.org/uniprot/P45260 P45260]
| + | {{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-MGCNEYSASA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q57625 Q57625]
| + | {{#set: common name=D-galactono-1,5-lactone}} |
− | ** [http://www.uniprot.org/uniprot/P37251 P37251]
| + | {{#set: common name=D-galactonolactone|D-galactonic acid δ-lactone|D-galactono-8-lactone|(3R,4S,5R,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one}} |
− | ** [http://www.uniprot.org/uniprot/P45261 P45261]
| + | {{#set: produced by=RXN-13740}} |
− | ** [http://www.uniprot.org/uniprot/O27493 O27493]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66759 O66759]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHU2 Q9PHU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/O05031 O05031]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57725 Q57725]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHU1 Q9PHU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTI1 Q9JTI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58077 Q58077]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28554 O28554]
| + | |
− | ** [http://www.uniprot.org/uniprot/O53554 O53554]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04789 Q04789]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JRF4 Q9JRF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59272 Q59272]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27696 P27696]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59498 Q59498]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RFQ7 Q9RFQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05767 Q05767]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40811 P40811]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21622 P21622]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27818 P27818]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41768 Q41768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41769 Q41769]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69684 P69684]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27819 P27819]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R586 Q9R586]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02137 Q02137]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02140 Q02140]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36620 P36620]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42767 Q42767]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42768 Q42768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49865 Q49865]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22547 O22547]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49229 O49229]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22578 O22578]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49210 O49210]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60021 Q60021]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07342 P07342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00892 P00892]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08142 P08142]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ADF8 P0ADF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00894 P00894]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00893 P00893]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17597 P17597]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09342 P09342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09114 P09114]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14874 P14874]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=acetolactate synthase small subunit}} | + | |
− | {{#set: ec number=EC-2.2.1.6}} | + | |
− | {{#set: gene associated=CHC_980|CHC_T00002409001_1|CHC_T00008160001_1}} | + | |
− | {{#set: in pathway=VALSYN-PWY|PWY-7111|PWY-6389|PWY-5938|PWY-5939}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=galdieria.sulphuraria}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=original_genome}}
| + | |