Difference between revisions of "LINAMARIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_NA+ ExchangeSeed_NA+] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_NA+ ExchangeSeed_NA+] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)
 +
* molecular weight:
 +
** 247.247   
 +
* inchi key:
 +
** InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N
 +
* common name:
 +
** linamarin
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile
 +
** 1-cyano-1-methylethyl beta-D-glucoside
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-5341]]
** 1.0 [[NA+]][C-BOUNDARY] '''<=>''' 1.0 [[NA+]][e]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-13602]]
** 1.0 Na+[C-BOUNDARY] '''<=>''' 1.0 Na+[e]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[manual]]:
+
** [[added to manage seeds from boundary to extracellular compartment]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* CAS : 554-35-8
{{#set: in pathway=}}
+
* HMDB : HMDB33699
{{#set: reconstruction category=manual}}
+
* CHEMSPIDER:
{{#set: reconstruction source=added to manage seeds from boundary to extracellular compartment}}
+
** [http://www.chemspider.com/Chemical-Structure.10657.html 10657]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16441 16441]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01594 C01594]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11128 11128]
 +
{{#set: smiles=CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)}}
 +
{{#set: molecular weight=247.247    }}
 +
{{#set: inchi key=InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N}}
 +
{{#set: common name=linamarin}}
 +
{{#set: common name=2-(&beta;-D-glucopyranosyloxy)-2-methylpropanenitrile|1-cyano-1-methylethyl beta-D-glucoside}}
 +
{{#set: consumed by=RXN-5341}}
 +
{{#set: produced by=RXN-13602}}

Latest revision as of 18:39, 9 January 2019

Metabolite LINAMARIN

  • smiles:
    • CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)
  • molecular weight:
    • 247.247
  • inchi key:
    • InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N
  • common name:
    • linamarin
  • Synonym(s):
    • 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile
    • 1-cyano-1-methylethyl beta-D-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links