Difference between revisions of "LINAMARIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * smiles: ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) | ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) | ||
+ | * molecular weight: | ||
+ | ** 247.247 | ||
* inchi key: | * inchi key: | ||
** InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N | ** InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N | ||
* common name: | * common name: | ||
** linamarin | ** linamarin | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile | ** 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile | ||
Line 20: | Line 20: | ||
== External links == | == External links == | ||
* CAS : 554-35-8 | * CAS : 554-35-8 | ||
− | |||
− | |||
* HMDB : HMDB33699 | * HMDB : HMDB33699 | ||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.10657.html 10657] | ** [http://www.chemspider.com/Chemical-Structure.10657.html 10657] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16441 16441] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16441 16441] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01594 C01594] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11128 11128] | ||
{{#set: smiles=CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)}} | {{#set: smiles=CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)}} | ||
+ | {{#set: molecular weight=247.247 }} | ||
{{#set: inchi key=InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N}} | {{#set: inchi key=InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N}} | ||
{{#set: common name=linamarin}} | {{#set: common name=linamarin}} | ||
− | |||
{{#set: common name=2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile|1-cyano-1-methylethyl beta-D-glucoside}} | {{#set: common name=2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile|1-cyano-1-methylethyl beta-D-glucoside}} | ||
{{#set: consumed by=RXN-5341}} | {{#set: consumed by=RXN-5341}} | ||
{{#set: produced by=RXN-13602}} | {{#set: produced by=RXN-13602}} |
Latest revision as of 18:39, 9 January 2019
Contents
Metabolite LINAMARIN
- smiles:
- CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)
- molecular weight:
- 247.247
- inchi key:
- InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N
- common name:
- linamarin
- Synonym(s):
- 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile
- 1-cyano-1-methylethyl beta-D-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links