Difference between revisions of "OLEOYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008519001 == * left end position: ** 12183 * transcription direction: ** POSITIVE * right end position: ** 13205 * centisome position: ** 25.9...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * molecular weight: |
− | ** | + | ** 1027.953 |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J |
− | * | + | * common name: |
− | ** | + | ** oleoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
+ | ** oloeyl-CoA (cis) | ||
+ | ** cis-octadec-9-enoyl-CoA | ||
+ | ** (9Z)-octadec-9-enoyl-CoA | ||
+ | ** 18:1 cis-9 | ||
+ | ** 18:1(n-9) | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-9601]] |
− | ** | + | * [[RXN-9666]] |
− | ** | + | * [[RXN-15043]] |
− | * [[RXN- | + | * [[RXN-17775]] |
− | * | + | * [[RXN-13322]] |
− | * | + | * [[RXN-15045]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-9644]] |
− | * [[ | + | * [[1.14.19.1-RXN]] |
+ | * [[RXN0-7239]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-15036]] | ||
+ | * [[RXN-9670]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57387 57387] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57387 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245426 25245426] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00510 C00510] | ||
+ | * HMDB : HMDB01322 | ||
+ | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: molecular weight=1027.953 }} | ||
+ | {{#set: inchi key=InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J}} | ||
+ | {{#set: common name=oleoyl-CoA}} | ||
+ | {{#set: common name=oloeyl-CoA (cis)|cis-octadec-9-enoyl-CoA|(9Z)-octadec-9-enoyl-CoA|18:1 cis-9|18:1(n-9)}} | ||
+ | {{#set: consumed by=RXN-9601|RXN-9666|RXN-15043|RXN-17775|RXN-13322|RXN-15045}} | ||
+ | {{#set: produced by=RXN-9644|1.14.19.1-RXN|RXN0-7239}} | ||
+ | {{#set: reversible reaction associated=RXN-15036|RXN-9670}} |
Latest revision as of 17:41, 9 January 2019
Contents
Metabolite OLEOYL-COA
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1027.953
- inchi key:
- InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J
- common name:
- oleoyl-CoA
- Synonym(s):
- oloeyl-CoA (cis)
- cis-octadec-9-enoyl-CoA
- (9Z)-octadec-9-enoyl-CoA
- 18:1 cis-9
- 18:1(n-9)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.