Difference between revisions of "OLEOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * molecular weight: | ||
| + | ** 1027.953 | ||
* inchi key: | * inchi key: | ||
** InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J | ** InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J | ||
* common name: | * common name: | ||
** oleoyl-CoA | ** oleoyl-CoA | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** oloeyl-CoA (cis) | ** oloeyl-CoA (cis) | ||
| Line 17: | Line 17: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9601]] |
* [[RXN-9666]] | * [[RXN-9666]] | ||
* [[RXN-15043]] | * [[RXN-15043]] | ||
| − | |||
| − | |||
* [[RXN-17775]] | * [[RXN-17775]] | ||
| + | * [[RXN-13322]] | ||
| + | * [[RXN-15045]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-9644]] | * [[RXN-9644]] | ||
| − | |||
* [[1.14.19.1-RXN]] | * [[1.14.19.1-RXN]] | ||
| + | * [[RXN0-7239]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-15036]] | ||
* [[RXN-9670]] | * [[RXN-9670]] | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57387 57387] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57387 57387] | ||
| Line 38: | Line 36: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245426 25245426] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245426 25245426] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00510 C00510] | ||
* HMDB : HMDB01322 | * HMDB : HMDB01322 | ||
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: molecular weight=1027.953 }} | ||
{{#set: inchi key=InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J}} | {{#set: inchi key=InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J}} | ||
{{#set: common name=oleoyl-CoA}} | {{#set: common name=oleoyl-CoA}} | ||
| − | |||
{{#set: common name=oloeyl-CoA (cis)|cis-octadec-9-enoyl-CoA|(9Z)-octadec-9-enoyl-CoA|18:1 cis-9|18:1(n-9)}} | {{#set: common name=oloeyl-CoA (cis)|cis-octadec-9-enoyl-CoA|(9Z)-octadec-9-enoyl-CoA|18:1 cis-9|18:1(n-9)}} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-9601|RXN-9666|RXN-15043|RXN-17775|RXN-13322|RXN-15045}} |
| − | {{#set: produced by=RXN-9644 | + | {{#set: produced by=RXN-9644|1.14.19.1-RXN|RXN0-7239}} |
| − | {{#set: reversible reaction associated=RXN- | + | {{#set: reversible reaction associated=RXN-15036|RXN-9670}} |
Latest revision as of 17:41, 9 January 2019
Contents
Metabolite OLEOYL-COA
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1027.953
- inchi key:
- InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J
- common name:
- oleoyl-CoA
- Synonym(s):
- oloeyl-CoA (cis)
- cis-octadec-9-enoyl-CoA
- (9Z)-octadec-9-enoyl-CoA
- 18:1 cis-9
- 18:1(n-9)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
