Difference between revisions of "CHC T00010112001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00010112001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[NADH-DEHYDROG-A-RXN]] |
− | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
− | * [[ | + | * Reaction: [[RXN0-5330]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | == Pathways associated == | ||
+ | * [[PWY0-1567]] | ||
+ | * [[PWY0-1335]] | ||
+ | * [[PWY-7279]] | ||
+ | * [[PWY0-1334]] | ||
+ | * [[PWY0-1568]] | ||
+ | * [[PWY-6692]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[PWY0-1573]] | ||
+ | * [[PWY-7269]] | ||
+ | * [[PWY-3781]] | ||
+ | * [[PWY-4302]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=NADH-DEHYDROG-A-RXN|RXN0-5330}} | |
− | + | {{#set: pathway associated=PWY0-1567|PWY0-1335|PWY-7279|PWY0-1334|PWY0-1568|PWY-6692|PWY-5083|PWY0-1573|PWY-7269|PWY-3781|PWY-4302}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 18:42, 9 January 2019
Gene CHC_T00010112001_1
- Synonym(s):
Reactions associated
- Reaction: NADH-DEHYDROG-A-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN0-5330
- Source: orthology-ectocarpus_siliculosus
Pathways associated
- PWY0-1567
- PWY0-1335
- PWY-7279
- PWY0-1334
- PWY0-1568
- PWY-6692
- PWY-5083
- PWY0-1573
- PWY-7269
- PWY-3781
- PWY-4302