Difference between revisions of "CPD-15684"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00006490001_1 == * Synonym(s): == Reactions associated == * INORGPYROPHOSPHAT-RXN ** pantograph-galdieria.sulphuraria ** pantogra...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00006490001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] ==
 +
* smiles:
 +
** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 969.83   
 +
* inchi key:
 +
** InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J
 +
* common name:
 +
** 5-cis, 7-trans-tetradecadienoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 5Z, 7E-tetradecadienoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[INORGPYROPHOSPHAT-RXN]]
+
* [[RXN-14796]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[a.taliana]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-7805]]
+
* [[PWY-7807]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=INORGPYROPHOSPHAT-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7805|PWY-7807}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659270 90659270]
 +
{{#set: smiles=CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: molecular weight=969.83    }}
 +
{{#set: inchi key=InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J}}
 +
{{#set: common name=5-cis, 7-trans-tetradecadienoyl-CoA}}
 +
{{#set: common name=5Z, 7E-tetradecadienoyl-CoA}}
 +
{{#set: consumed by=RXN-14796}}

Latest revision as of 18:42, 9 January 2019

Metabolite CPD-15684

  • smiles:
    • CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 969.83
  • inchi key:
    • InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J
  • common name:
    • 5-cis, 7-trans-tetradecadienoyl-CoA
  • Synonym(s):
    • 5Z, 7E-tetradecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.