Difference between revisions of "CPD-15836"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE-tRNAs ILE-tRNAs] == * common name: ** a tRNAile * Synonym(s): ** TRNA(ILE) == Reaction(s)...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15836 CPD-15836] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=C(C=2C)C)O)C)))C)C)C | ||
+ | * molecular weight: | ||
+ | ** 424.665 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RZFHLOLGZPDCHJ-XZXLULOTSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** α-tocotrienol |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14918]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33270 33270] |
− | {{#set: | + | * METABOLIGHTS : MTBLC33270 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282347 5282347] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C14153 C14153] | ||
+ | * HMDB : HMDB06327 | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=C(C=2C)C)O)C)))C)C)C}} | ||
+ | {{#set: molecular weight=424.665 }} | ||
+ | {{#set: inchi key=InChIKey=RZFHLOLGZPDCHJ-XZXLULOTSA-N}} | ||
+ | {{#set: common name=α-tocotrienol}} | ||
+ | {{#set: produced by=RXN-14918}} |
Latest revision as of 17:43, 9 January 2019
Contents
Metabolite CPD-15836
- smiles:
- CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=C(C(=C(C=2C)C)O)C)))C)C)C
- molecular weight:
- 424.665
- inchi key:
- InChIKey=RZFHLOLGZPDCHJ-XZXLULOTSA-N
- common name:
- α-tocotrienol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links