Difference between revisions of "CPD-19167"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00007954001_1 == * Synonym(s): == Reactions associated == * PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN ** pantograph-galdieria.sulphura...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00007954001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
 +
* smiles:
 +
** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 1013.883   
 +
* inchi key:
 +
** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
 +
* common name:
 +
** 3-oxo-(7Z)-hexadecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-16:1-Δ7-CoA
 +
** 3-oxo-7-cis-hexadecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN]]
+
* [[RXN-17782]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RXN-17781]]
* [[PWY-101]]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN}}
+
{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: pathway associated=PWY-101}}
+
{{#set: molecular weight=1013.883    }}
 +
{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
 +
{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
 +
{{#set: common name=3-oxo-16:1-Δ7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17782}}
 +
{{#set: produced by=RXN-17781}}

Latest revision as of 17:43, 9 January 2019

Metabolite CPD-19167

  • smiles:
    • CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 1013.883
  • inchi key:
    • InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
  • common name:
    • 3-oxo-(7Z)-hexadecenoyl-CoA
  • Synonym(s):
    • 3-oxo-16:1-Δ7-CoA
    • 3-oxo-7-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.