Difference between revisions of "CPD-3801"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008748001_1 == * Synonym(s): == Reactions associated == * RXN-11109 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == |
+ | * smiles: | ||
+ | ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O | ||
+ | * molecular weight: | ||
+ | ** 357.291 | ||
+ | * inchi key: | ||
+ | ** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M | ||
+ | * common name: | ||
+ | ** melibionate | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** melibionic acid | ||
+ | ** 6-O-α-D-galactopyranosyl-D-gluconic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-17754]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771] | ||
+ | {{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}} | ||
+ | {{#set: molecular weight=357.291 }} | ||
+ | {{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}} | ||
+ | {{#set: common name=melibionate}} | ||
+ | {{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}} | ||
+ | {{#set: consumed by=RXN-17754}} |
Latest revision as of 17:45, 9 January 2019
Contents
Metabolite CPD-3801
- smiles:
- C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
- molecular weight:
- 357.291
- inchi key:
- InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
- common name:
- melibionate
- Synonym(s):
- melibionic acid
- 6-O-α-D-galactopyranosyl-D-gluconic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.