Difference between revisions of "CPD-3801"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * inchi...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O | ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O | ||
| + | * molecular weight: | ||
| + | ** 357.291 | ||
* inchi key: | * inchi key: | ||
** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M | ** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M | ||
* common name: | * common name: | ||
** melibionate | ** melibionate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** melibionic acid | ** melibionic acid | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771] | ||
{{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}} | {{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}} | ||
| + | {{#set: molecular weight=357.291 }} | ||
{{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}} | {{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}} | ||
{{#set: common name=melibionate}} | {{#set: common name=melibionate}} | ||
| − | |||
{{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}} | {{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}} | ||
{{#set: consumed by=RXN-17754}} | {{#set: consumed by=RXN-17754}} | ||
Latest revision as of 17:45, 9 January 2019
Contents
Metabolite CPD-3801
- smiles:
- C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
- molecular weight:
- 357.291
- inchi key:
- InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
- common name:
- melibionate
- Synonym(s):
- melibionic acid
- 6-O-α-D-galactopyranosyl-D-gluconic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.
