Difference between revisions of "3-KETOLACTOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-ACETYLTRANSFER-RXN ACETYL-COA-ACETYLTRANSFER-RXN] == * direction: ** REVERSIBLE * common...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-ACETYLTRANSFER-RXN ACETYL-COA-ACETYLTRANSFER-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
 +
* molecular weight:
 +
** 340.283   
 +
* inchi key:
 +
** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
 
* common name:
 
* common name:
** acetyl-CoA acetyltransferase
+
** 3'-ketolactose
* ec number:
+
** [http://enzyme.expasy.org/EC/2.3.1.9 EC-2.3.1.9]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[KETOLACTOSE-RXN]]
** 2 [[ACETYL-COA]][c] '''<=>''' 1 [[ACETOACETYL-COA]][c] '''+''' 1 [[CO-A]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 2 acetyl-CoA[c] '''<=>''' 1 acetoacetyl-CoA[c] '''+''' 1 coenzyme A[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008981001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
** [[pantograph]]-[[a.taliana]]
+
** [[pantograph]]-[[a.taliana]]
+
** [[pantograph]]-[[a.taliana]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00008981001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[P162-PWY]], L-glutamate degradation V (via hydroxyglutarate): [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY]
+
** '''4''' reactions found over '''11''' reactions in the full pathway
+
* [[PWY-5177]], glutaryl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-6583]], pyruvate fermentation to butanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583]
+
** '''5''' reactions found over '''8''' reactions in the full pathway
+
* [[P163-PWY]], L-lysine fermentation to acetate and butanoate: [http://metacyc.org/META/NEW-IMAGE?object=P163-PWY P163-PWY]
+
** '''1''' reactions found over '''10''' reactions in the full pathway
+
* [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883]
+
** '''5''' reactions found over '''6''' reactions in the full pathway
+
* [[PWY-5676]], acetyl-CoA fermentation to butanoate II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5676 PWY-5676]
+
** '''1''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY-6588]], pyruvate fermentation to acetone: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6588 PWY-6588]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-7779]], methyl tert-butyl ether degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7779 PWY-7779]
+
** '''2''' reactions found over '''10''' reactions in the full pathway
+
* [[PWY-7778]], 2-methylpropene degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7778 PWY-7778]
+
** '''2''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY1-3]], polyhydroxybutanoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1-3 PWY1-3]
+
** '''1''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
+
** '''5''' reactions found over '''16''' reactions in the full pathway
+
* [[PWY-6876]], isopropanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6876 PWY-6876]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
* [[CENTFERM-PWY]], pyruvate fermentation to butanoate: [http://metacyc.org/META/NEW-IMAGE?object=CENTFERM-PWY CENTFERM-PWY]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391]
+
** '''7''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY-5741]], ethylmalonyl-CoA pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5741 PWY-5741]
+
** '''1''' reactions found over '''11''' reactions in the full pathway
+
* [[PWY-6174]], mevalonate pathway II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174]
+
** '''7''' reactions found over '''7''' reactions in the full pathway
+
* [[ACETOACETATE-DEG-PWY]], acetoacetate degradation (to acetyl CoA): [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETATE-DEG-PWY ACETOACETATE-DEG-PWY]
+
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[PWY66-367]], ketogenesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-367 PWY66-367]
+
** '''4''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-7216]], (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922]
+
** '''7''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY66-368]], ketolysis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368]
+
** '''1''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-7401]], crotonate fermentation (to acetate and cyclohexane carboxylate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7401 PWY-7401]
+
** '''3''' reactions found over '''17''' reactions in the full pathway
+
* [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
+
** '''8''' reactions found over '''11''' reactions in the full pathway
+
* [[PWY-7524]], mevalonate pathway III (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524]
+
** '''5''' reactions found over '''8''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
*** [[a.taliana]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* CHEBI:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21036 21036]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571]
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R00238 R00238]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057]
* UNIPROT:
+
* LIGAND-CPD:
** [http://www.uniprot.org/uniprot/Q8CAY6 Q8CAY6]
+
** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403]
** [http://www.uniprot.org/uniprot/P41338 P41338]
+
* KEGG-GLYCAN : G10531
** [http://www.uniprot.org/uniprot/P45362 P45362]
+
* HMDB : HMDB01030
** [http://www.uniprot.org/uniprot/Q9BWD1 Q9BWD1]
+
{{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}}
** [http://www.uniprot.org/uniprot/P45359 P45359]
+
{{#set: molecular weight=340.283    }}
** [http://www.uniprot.org/uniprot/P24752 P24752]
+
{{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}}
** [http://www.uniprot.org/uniprot/Q12598 Q12598]
+
{{#set: common name=3'-ketolactose}}
** [http://www.uniprot.org/uniprot/P45369 P45369]
+
{{#set: common name=3'-dehydro-&beta;-D-galactosyl-&beta;-D-glucopyranoside}}
** [http://www.uniprot.org/uniprot/P46707 P46707]
+
{{#set: consumed by=KETOLACTOSE-RXN}}
** [http://www.uniprot.org/uniprot/P73825 P73825]
+
** [http://www.uniprot.org/uniprot/Q43637 Q43637]
+
** [http://www.uniprot.org/uniprot/Q9UQW6 Q9UQW6]
+
** [http://www.uniprot.org/uniprot/Q9Z3Y4 Q9Z3Y4]
+
** [http://www.uniprot.org/uniprot/P77852 P77852]
+
** [http://www.uniprot.org/uniprot/Q9XD81 Q9XD81]
+
** [http://www.uniprot.org/uniprot/Q9ZGI9 Q9ZGI9]
+
** [http://www.uniprot.org/uniprot/Q9L8E0 Q9L8E0]
+
** [http://www.uniprot.org/uniprot/P14611 P14611]
+
** [http://www.uniprot.org/uniprot/P07097 P07097]
+
** [http://www.uniprot.org/uniprot/P17764 P17764]
+
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=acetyl-CoA acetyltransferase}}
+
{{#set: ec number=EC-2.3.1.9}}
+
{{#set: gene associated=CHC_T00008981001_1|CHC_T00008981001}}
+
{{#set: in pathway=P162-PWY|PWY-5177|PWY-6583|P163-PWY|PWY-6883|PWY-5676|PWY-6588|PWY-7779|PWY-7778|PWY1-3|PWY-5789|PWY-6876|CENTFERM-PWY|PWY-7391|PWY-5741|PWY-6174|ACETOACETATE-DEG-PWY|PWY66-367|PWY-7216|PWY-922|PWY66-368|PWY-7401|PWY-6863|PWY-7524}}
+
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 17:45, 9 January 2019

Metabolite 3-KETOLACTOSE

  • smiles:
    • C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
  • molecular weight:
    • 340.283
  • inchi key:
    • InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
  • common name:
    • 3'-ketolactose
  • Synonym(s):
    • 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links