Difference between revisions of "CPD-14893"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETATE-DECARBOXYLASE-RXN ACETOACETATE-DECARBOXYLASE-RXN] == * direction: ** LEFT-TO-RIGHT * e...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETATE-DECARBOXYLASE-RXN ACETOACETATE-DECARBOXYLASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/4.1.1.4 EC-4.1.1.4]
+
** 400.687   
 +
* inchi key:
 +
** InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N
 +
* common name:
 +
** ergost-7-enol
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-13883]]
** 1 [[PROTON]][c] '''+''' 1 [[3-KETOBUTYRATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACETONE]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H+[c] '''+''' 1 acetoacetate[c] '''=>''' 1 CO2[c] '''+''' 1 acetone[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY66-367]], ketogenesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-367 PWY66-367]
+
** '''4''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-5451]], acetone degradation I (to methylglyoxal): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5451 PWY-5451]
+
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6588]], pyruvate fermentation to acetone: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6588 PWY-6588]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-7466]], acetone degradation III (to propane-1,2-diol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7466 PWY-7466]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6876]], isopropanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6876 PWY-6876]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* CHEBI:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19729 19729]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=69432 69432]
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R01366 R01366]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283646 5283646]
* UNIPROT:
+
* CAS : 516-78-9
** [http://www.uniprot.org/uniprot/P23670 P23670]
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: molecular weight=400.687    }}
{{#set: ec number=EC-4.1.1.4}}
+
{{#set: inchi key=InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N}}
{{#set: in pathway=PWY66-367|PWY-5451|PWY-6588|PWY-7466|PWY-6876}}
+
{{#set: common name=ergost-7-enol}}
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-13883}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 17:45, 9 January 2019

Metabolite CPD-14893

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • molecular weight:
    • 400.687
  • inchi key:
    • InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N
  • common name:
    • ergost-7-enol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.