Difference between revisions of "CPD-4186"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] == |
* smiles: | * smiles: | ||
− | ** CC( | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C |
+ | * molecular weight: | ||
+ | ** 386.66 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N |
* common name: | * common name: | ||
− | ** | + | ** lathosterol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** 7 | + | ** 5α-cholest-7-en-3β-ol |
− | ** | + | ** α-cholest-7-en-3β-ol |
− | ** 7 | + | ** cholesta-7-enol |
+ | ** Δ7-cholesten-3-β-ol | ||
+ | ** γ-cholesterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.14.21.6-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17168 17168] |
+ | * CAS : 80-99-9 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65728 65728] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01189 C01189] |
− | * HMDB : | + | * HMDB : HMDB01170 |
− | {{#set: smiles=CC( | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=386.66 }} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N}} |
− | + | {{#set: common name=lathosterol}} | |
− | {{#set: common name=7 | + | {{#set: common name=5α-cholest-7-en-3β-ol|α-cholest-7-en-3β-ol|cholesta-7-enol|Δ7-cholesten-3-β-ol|γ-cholesterol}} |
− | + | {{#set: consumed by=1.14.21.6-RXN}} | |
− | + | ||
− | {{#set: consumed | + |
Latest revision as of 17:46, 9 January 2019
Contents
Metabolite CPD-4186
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C
- molecular weight:
- 386.66
- inchi key:
- InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N
- common name:
- lathosterol
- Synonym(s):
- 5α-cholest-7-en-3β-ol
- α-cholest-7-en-3β-ol
- cholesta-7-enol
- Δ7-cholesten-3-β-ol
- γ-cholesterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.