Difference between revisions of "RXN-12565"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12565 RXN-12565] ==
* smiles:
+
* direction:
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
+
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
* common name:
+
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
+
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
** 5α-cholesta-8,24-dien-3β-ol
 
** 4α,14α-dimethylzymosterol
 
** 29-norlanosterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-11881]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[BUTYRYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[K-HEXANOYL-COA]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 acetyl-CoA[c] '''+''' 1 butanoyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 3-oxohexanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008981001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00009349001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009422001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
 +
** '''10''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15101557 15101557]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31113 31113]
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
* LIGAND-RXN:
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R01177 R01177]
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: molecular weight=412.698    }}
+
{{#set: ec number=EC-2.3.1.16}}
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}}
+
{{#set: gene associated=CHC_T00008981001_1|CHC_T00009349001_1|CHC_T00009422001_1}}
{{#set: consumed by=RXN-11881}}
+
{{#set: in pathway=PWY-6863}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 18:47, 9 January 2019

Reaction RXN-12565

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6863, pyruvate fermentation to hexanol (engineered): PWY-6863
    • 10 reactions found over 11 reactions in the full pathway

Reconstruction information

External links