Difference between revisions of "CPD-7025"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10696 RXN-10696] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA oxidase * ec numbe...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C |
+ | * molecular weight: | ||
+ | ** 374.499 | ||
+ | * inchi key: | ||
+ | ** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** phytyl monophosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** phytolmonophosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-7683]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483] | |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113] | |
− | {{#set: | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}} |
− | + | {{#set: molecular weight=374.499 }} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}} |
− | {{#set: | + | {{#set: common name=phytyl monophosphate}} |
− | {{#set: | + | {{#set: common name=phytolmonophosphate}} |
− | {{#set: | + | {{#set: produced by=RXN-7683}} |
− | {{#set: | + |
Latest revision as of 17:47, 9 January 2019
Contents
Metabolite CPD-7025
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
- molecular weight:
- 374.499
- inchi key:
- InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
- common name:
- phytyl monophosphate
- Synonym(s):
- phytolmonophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C" cannot be used as a page name in this wiki.