Difference between revisions of "OROTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-578 CPD-578] == * smiles: ** C(N)(NC([O-])=O)=O * inchi key: ** InChIKey=AVWRKZWQTYIKIY-UHF...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) |
| + | * molecular weight: | ||
| + | ** 155.09 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** orotate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** orotic acid |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[OROPRIBTRANS-RXN]] | ||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC30839 |
| − | * | + | * BIGG : orot |
| − | * | + | * CAS : 65-86-1 |
| − | * | + | * HMDB : HMDB00226 |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30839 30839] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00295 C00295] |
| − | {{#set: smiles=C( | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1492348 1492348] |
| − | {{#set: | + | {{#set: smiles=C1(=C(C([O-])=O)NC(NC(=O)1)=O)}} |
| − | {{#set: | + | {{#set: molecular weight=155.09 }} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=orotate}} |
| − | + | {{#set: common name=orotic acid}} | |
| + | {{#set: reversible reaction associated=OROPRIBTRANS-RXN}} | ||
Latest revision as of 18:51, 9 January 2019
Contents
Metabolite OROTATE
- smiles:
- C1(=C(C([O-])=O)NC(NC(=O)1)=O)
- molecular weight:
- 155.09
- inchi key:
- InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M
- common name:
- orotate
- Synonym(s):
- orotic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC30839
- BIGG : orot
- CAS : 65-86-1
- HMDB : HMDB00226
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C1(=C(C([O-])=O)NC(NC(=O)1)=O)" cannot be used as a page name in this wiki.
