Difference between revisions of "Gcv-H"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Gcv-H Gcv-H] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
** geranylgeranyl chlorophyll b
+
** [glycine cleavage system lipoyl-carrier protein]-L-lysine
* molecular weight:
+
** 901.439   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13037]]
 +
* [[RXN0-1141]]
 +
* [[RXN-13039]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-7673]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=[glycine cleavage system lipoyl-carrier protein]-L-lysine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245917 25245917]
+
{{#set: consumed by=RXN-13037|RXN0-1141|RXN-13039}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=geranylgeranyl chlorophyll b}}
+
{{#set: molecular weight=901.439    }}
+
{{#set: consumed or produced by=RXN-7673}}
+

Latest revision as of 18:52, 9 January 2019

Metabolite Gcv-H

  • common name:
    • [glycine cleavage system lipoyl-carrier protein]-L-lysine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"glycine cleavage system lipoyl-carrier protein]-L-lysine" cannot be used as a page name in this wiki.