Difference between revisions of "CPD-14594"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxyglutaryl-ACP-methyl-ester 3-Hydroxyglutaryl-ACP-methyl-ester] == * common name: ** a (...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == |
| + | * smiles: | ||
| + | ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C | ||
| + | * molecular weight: | ||
| + | ** 409.389 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** linustatin |
* Synonym(s): | * Synonym(s): | ||
| + | ** propanenitrile | ||
| + | ** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13602]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333] | ||
| + | {{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}} | ||
| + | {{#set: molecular weight=409.389 }} | ||
| + | {{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}} | ||
| + | {{#set: common name=linustatin}} | ||
| + | {{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}} | ||
| + | {{#set: consumed by=RXN-13602}} | ||
Latest revision as of 17:52, 9 January 2019
Contents
Metabolite CPD-14594
- smiles:
- CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
- molecular weight:
- 409.389
- inchi key:
- InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
- common name:
- linustatin
- Synonym(s):
- propanenitrile
- [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
