Difference between revisions of "QUINATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.99.18-RXN 4.2.99.18-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == |
− | * | + | * smiles: |
− | ** | + | ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) |
− | * | + | * molecular weight: |
− | ** | + | ** 191.16 |
+ | * inchi key: | ||
+ | ** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M | ||
+ | * common name: | ||
+ | ** L-quinate | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (-)-quinic acid | ||
+ | ** (-)-quinate | ||
+ | ** (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-7967]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751] |
− | + | * CAS : 77-95-2 | |
− | + | * PUBCHEM: | |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034] |
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296] |
− | + | * CHEMSPIDER: | |
− | + | ** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058] | |
− | * | + | {{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}} |
− | ** [http://www. | + | {{#set: molecular weight=191.16 }} |
− | * | + | {{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}} |
− | ** [http://www. | + | {{#set: common name=L-quinate}} |
− | + | {{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}} | |
− | + | {{#set: consumed by=RXN-7967}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:53, 9 January 2019
Contents
Metabolite QUINATE
- smiles:
- C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
- molecular weight:
- 191.16
- inchi key:
- InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
- common name:
- L-quinate
- Synonym(s):
- (-)-quinic acid
- (-)-quinate
- (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)" cannot be used as a page name in this wiki.