Difference between revisions of "CPD-15838"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHLORETIN PHLORETIN] == * smiles: ** C1(C=C(C=CC=1CCC(C2(C(=CC(O)=CC(O)=2)O))=O)O) * inchi key:...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15838 CPD-15838] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=C(C)C=2C)O)))C)C)C |
+ | * molecular weight: | ||
+ | ** 410.639 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OTXNTMVVOOBZCV-WAZJVIJMSA-N |
* common name: | * common name: | ||
− | ** | + | ** γ-tocotrienol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14918]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33277 33277] | |
− | ** [http:// | + | * METABOLIGHTS : MTBLC33277 |
− | * | + | |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282349 5282349] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14155 C14155] |
− | * | + | * HMDB : HMDB12958 |
− | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=C(C)C=2C)O)))C)C)C}} | |
− | + | {{#set: molecular weight=410.639 }} | |
− | + | {{#set: inchi key=InChIKey=OTXNTMVVOOBZCV-WAZJVIJMSA-N}} | |
− | + | {{#set: common name=γ-tocotrienol}} | |
− | {{#set: smiles= | + | {{#set: consumed by=RXN-14918}} |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 18:54, 9 January 2019
Contents
Metabolite CPD-15838
- smiles:
- CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=C(C)C=2C)O)))C)C)C
- molecular weight:
- 410.639
- inchi key:
- InChIKey=OTXNTMVVOOBZCV-WAZJVIJMSA-N
- common name:
- γ-tocotrienol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links