Difference between revisions of "ITP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-480 RXN66-480] == * direction: ** LEFT-TO-RIGHT * common name: ** phytenoyl-CoA synthetase **...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-480 RXN66-480] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
 +
* molecular weight:
 +
** 504.137   
 +
* inchi key:
 +
** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
 
* common name:
 
* common name:
−
** phytenoyl-CoA synthetase
+
** ITP
−
** long-chain-fatty-acid-CoA ligase
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** inosine triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-5073]]
−
** 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-14927]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[CPD-14928]][c]
+
* [[RXN0-6382]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 ATP[c] '''+''' 1 coenzyme A[c] '''+''' 1 phytenate[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 phytenoyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-14120]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008160001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00009428001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008811001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00009428001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00008811001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008500001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY66-389]], phytol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-389 PWY66-389]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* BIGG : itp
−
{{#set: common name=phytenoyl-CoA synthetase}}
+
* CAS : 132-06-9
−
{{#set: common name=long-chain-fatty-acid-CoA ligase}}
+
* HMDB : HMDB00189
−
{{#set: ec number=EC-6.2.1.3}}
+
* CHEBI:
−
{{#set: gene associated=CHC_T00008160001_1|CHC_T00009428001|CHC_T00008811001_1|CHC_T00009428001_1|CHC_T00008811001|CHC_T00008500001_1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402]
−
{{#set: in pathway=PWY66-389}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081]
−
{{#set: reconstruction tool=pantograph}}
+
* PUBCHEM:
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439]
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=504.137    }}
−
{{#set: reconstruction source=original_genome}}
+
{{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}}
 +
{{#set: common name=ITP}}
 +
{{#set: common name=inosine triphosphate}}
 +
{{#set: consumed by=RXN0-5073|RXN0-6382}}
 +
{{#set: reversible reaction associated=RXN-14120}}

Latest revision as of 17:55, 9 January 2019

Metabolite ITP

  • smiles:
    • C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
  • molecular weight:
    • 504.137
  • inchi key:
    • InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
  • common name:
    • ITP
  • Synonym(s):
    • inosine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • BIGG : itp
  • CAS : 132-06-9
  • HMDB : HMDB00189
  • CHEBI:
  • LIGAND-CPD:
  • PUBCHEM:
"C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=ITP&oldid=23671"