Difference between revisions of "CPD-9451"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ILE-tRNAs Charged-ILE-tRNAs] == * common name: ** an L-isoleucyl-[tRNAile] * Synonym(s)...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ILE-tRNAs Charged-ILE-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] ==
 +
* smiles:
 +
** CC(C(C(=O)[O-])=CC(=O)[O-])C
 +
* molecular weight:
 +
** 156.138   
 +
* inchi key:
 +
** InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
 
* common name:
 
* common name:
** an L-isoleucyl-[tRNAile]
+
** 2-isopropylmaleate
 
* Synonym(s):
 
* Synonym(s):
 +
** β-isopropylmaleate
 +
** 2-isopropylmaleic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[3-ISOPROPYLMALISOM-RXN]]
 +
* [[RXN-8991]]
 
== External links  ==
 
== External links  ==
{{#set: common name=an L-isoleucyl-[tRNAile]}}
+
* BIGG : 2ippm
{{#set: produced by=ISOLEUCINE--TRNA-LIGASE-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02631 C02631]
 +
* HMDB : HMDB12241
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10710392.html 10710392]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58085 58085]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21954611 21954611]
 +
{{#set: smiles=CC(C(C(=O)[O-])=CC(=O)[O-])C}}
 +
{{#set: molecular weight=156.138    }}
 +
{{#set: inchi key=InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L}}
 +
{{#set: common name=2-isopropylmaleate}}
 +
{{#set: common name=β-isopropylmaleate|2-isopropylmaleic acid}}
 +
{{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-8991}}

Latest revision as of 18:55, 9 January 2019

Metabolite CPD-9451

  • smiles:
    • CC(C(C(=O)[O-])=CC(=O)[O-])C
  • molecular weight:
    • 156.138
  • inchi key:
    • InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
  • common name:
    • 2-isopropylmaleate
  • Synonym(s):
    • β-isopropylmaleate
    • 2-isopropylmaleic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(C(=O)[O-])=CC(=O)[O-])C" cannot be used as a page name in this wiki.