Difference between revisions of "XTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11476 RXN-11476] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-glutaryl-[acp] methyl...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11476 RXN-11476] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
 +
* molecular weight:
 +
** 520.136   
 +
* inchi key:
 +
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
 
* common name:
 
* common name:
−
** 3-oxo-glutaryl-[acp] methyl ester reductase
+
** XTP
−
** beta-ketoacyl reductase
+
−
** 3-oxoacyl-[acyl-carrier-protein] reductase
+
−
** 3-oxoacyl-(acyl-carrier-protein) reductase
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** xanthosine 5' triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-1603]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-Ketoglutaryl-ACP-methyl-ester]][c] '''=>''' 1 [[3-Hydroxyglutaryl-ACP-methyl-ester]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-glutaryl-[acp] methyl ester[c] '''=>''' 1 a (3R)-3-hydroxyglutaryl-[acp] methyl ester[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008477001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008557001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008496001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008517001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
−
** '''7''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=3-oxo-glutaryl-[acp] methyl ester reductase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
−
{{#set: common name=beta-ketoacyl reductase}}
+
* BIGG : xtp
−
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] reductase}}
+
* PUBCHEM:
−
{{#set: common name=3-oxoacyl-(acyl-carrier-protein) reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
−
{{#set: ec number=EC-1.1.1.100}}
+
* LIGAND-CPD:
−
{{#set: gene associated=CHC_T00008477001|CHC_T00008557001|CHC_T00008496001|CHC_T00008517001_1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
−
{{#set: in pathway=PWY-6519}}
+
* HMDB : HMDB00293
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=520.136    }}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=XTP}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=xanthosine 5' triphosphate}}
−
{{#set: reconstruction source=original_genome}}
+
{{#set: consumed by=RXN0-1603}}

Latest revision as of 17:56, 9 January 2019

Metabolite XTP

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
  • molecular weight:
    • 520.136
  • inchi key:
    • InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
  • common name:
    • XTP
  • Synonym(s):
    • xanthosine 5' triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=XTP&oldid=23687"