Difference between revisions of "CPD-13376"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14273 CPD-14273] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)C...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == |
* smiles: | * smiles: | ||
− | ** | + | ** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1225.073 |
+ | * inchi key: | ||
+ | ** InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N | ||
+ | * common name: | ||
+ | ** XXLG xyloglucan oligosaccharide | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12398]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940123 52940123] |
− | + | {{#set: smiles=C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}} | |
− | + | {{#set: molecular weight=1225.073 }} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N}} |
− | {{#set: | + | {{#set: common name=XXLG xyloglucan oligosaccharide}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-12398}} |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: consumed by=RXN- | + | |
− | + |
Latest revision as of 17:57, 9 January 2019
Contents
Metabolite CPD-13376
- smiles:
- C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
- molecular weight:
- 1225.073
- inchi key:
- InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N
- common name:
- XXLG xyloglucan oligosaccharide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: