Difference between revisions of "CPD-11975"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5161 CPD-5161] == * common name: ** α-D-Man-(1→3)-β-D-Man-(1→4)-β...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11975 CPD-11975] == |
| + | * smiles: | ||
| + | ** CC(=O)NC2(C(OC1(C(O)C(O)C(O)C(OP([O-])(=O)[O-])C(O)1))OC(C(C2O)O)CO) | ||
| + | * molecular weight: | ||
| + | ** 461.316 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CHTTVMDQGBOCME-DNSWDBFXSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-O-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol 3-phosphate |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** GlcNAc-Ins-P |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-6501]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58892 58892] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: produced by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878470 46878470] |
| + | {{#set: smiles=CC(=O)NC2(C(OC1(C(O)C(O)C(O)C(OP([O-])(=O)[O-])C(O)1))OC(C(C2O)O)CO)}} | ||
| + | {{#set: molecular weight=461.316 }} | ||
| + | {{#set: inchi key=InChIKey=CHTTVMDQGBOCME-DNSWDBFXSA-L}} | ||
| + | {{#set: common name=1-O-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol 3-phosphate}} | ||
| + | {{#set: common name=GlcNAc-Ins-P}} | ||
| + | {{#set: produced by=RXN-6501}} | ||
Latest revision as of 17:58, 9 January 2019
Contents
Metabolite CPD-11975
- smiles:
- CC(=O)NC2(C(OC1(C(O)C(O)C(O)C(OP([O-])(=O)[O-])C(O)1))OC(C(C2O)O)CO)
- molecular weight:
- 461.316
- inchi key:
- InChIKey=CHTTVMDQGBOCME-DNSWDBFXSA-L
- common name:
- 1-O-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol 3-phosphate
- Synonym(s):
- GlcNAc-Ins-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC2(C(OC1(C(O)C(O)C(O)C(OP([O-])(=O)[O-])C(O)1))OC(C(C2O)O)CO)" cannot be used as a page name in this wiki.
