Difference between revisions of "CPD-19162"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12570 RXN-12570] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12570 RXN-12570] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
+
** 997.883   
 +
* inchi key:
 +
** InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J
 +
* common name:
 +
** (2E,9Z)-hexadecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 16:2-Δ2,Δ9-CoA
 +
** 2-trans,9-cis-hexadecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17789]]
** 1 [[K-HEXANOYL-COA]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[OH-HEXANOYL-COA]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17788]]
** 1 3-oxohexanoyl-CoA[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 (S)-3-hydroxyhexanoyl-CoA[c] '''+''' 1 NAD+[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008882001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00009349001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00008557001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00009422001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
+
** '''8''' reactions found over '''11''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
{{#set: smiles=CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31144 31144]
+
{{#set: molecular weight=997.883    }}
* LIGAND-RXN:
+
{{#set: inchi key=InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J}}
** [http://www.genome.jp/dbget-bin/www_bget?R04748 R04748]
+
{{#set: common name=(2E,9Z)-hexadecenoyl-CoA}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=16:2-Δ2,Δ9-CoA|2-trans,9-cis-hexadecenoyl-CoA}}
{{#set: ec number=EC-1.1.1.35}}
+
{{#set: consumed by=RXN-17789}}
{{#set: gene associated=CHC_T00008882001_1|CHC_T00009349001_1|CHC_T00008557001_1|CHC_T00009422001_1}}
+
{{#set: produced by=RXN-17788}}
{{#set: in pathway=PWY-6863}}
+
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+

Latest revision as of 19:02, 9 January 2019

Metabolite CPD-19162

  • smiles:
    • CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 997.883
  • inchi key:
    • InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J
  • common name:
    • (2E,9Z)-hexadecenoyl-CoA
  • Synonym(s):
    • 16:2-Δ2,Δ9-CoA
    • 2-trans,9-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.