Difference between revisions of "CPD-12121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5170 CPD-5170] == * common name: ** α-D-Glc-(1→3)-α-D-Glc-(1→3)-&alph...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12121 CPD-12121] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C | ||
+ | * molecular weight: | ||
+ | ** 977.59 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NKCMHMXWLADGOV-RVHIBIGXSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** demethylmenaquinol-12 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** DMK-12 |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9363]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84551 84551] |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479580 45479580] | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C}} | ||
+ | {{#set: molecular weight=977.59 }} | ||
+ | {{#set: inchi key=InChIKey=NKCMHMXWLADGOV-RVHIBIGXSA-N}} | ||
+ | {{#set: common name=demethylmenaquinol-12}} | ||
+ | {{#set: common name=DMK-12}} | ||
+ | {{#set: consumed by=RXN-9363}} |
Latest revision as of 18:03, 9 January 2019
Contents
Metabolite CPD-12121
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C
- molecular weight:
- 977.59
- inchi key:
- InChIKey=NKCMHMXWLADGOV-RVHIBIGXSA-N
- common name:
- demethylmenaquinol-12
- Synonym(s):
- DMK-12
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links