Difference between revisions of "DCTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ||
| + | * molecular weight: | ||
| + | ** 463.127 | ||
* inchi key: | * inchi key: | ||
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J | ** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J | ||
* common name: | * common name: | ||
** dCTP | ** dCTP | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** 2'-deoxycytidine-5'-triphosphate | ** 2'-deoxycytidine-5'-triphosphate | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[DCTP-PYROPHOSPHATASE-RXN]] | * [[DCTP-PYROPHOSPHATASE-RXN]] | ||
| + | * [[RXN-14216]] | ||
* [[RXN-14198]] | * [[RXN-14198]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| Line 22: | Line 22: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * BIGG : dctp | ||
* CAS : 2056-98-6 | * CAS : 2056-98-6 | ||
| − | |||
| − | |||
* HMDB : HMDB00998 | * HMDB : HMDB00998 | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665] | ||
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
| + | {{#set: molecular weight=463.127 }} | ||
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}} | {{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}} | ||
{{#set: common name=dCTP}} | {{#set: common name=dCTP}} | ||
| − | |||
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} | {{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=DCTP-PYROPHOSPHATASE-RXN|RXN-14216|RXN-14198}} |
{{#set: produced by=DCDPKIN-RXN}} | {{#set: produced by=DCDPKIN-RXN}} | ||
Latest revision as of 18:05, 9 January 2019
Contents
Metabolite DCTP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- molecular weight:
- 463.127
- inchi key:
- InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
- common name:
- dCTP
- Synonym(s):
- 2'-deoxycytidine-5'-triphosphate
- deoxycytidine-triphosphate
- deoxy-CTP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
