Difference between revisions of "PHYTYL-PYROPHOSPHATE"
From metabolic_network
(Created page with "{{#ask: Category:Reaction reconstruction tool::meneco | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source | ?gene as...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | + | [[Category:Metabolite]] | |
− | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] == | |
− | + | * smiles: | |
− | + | ** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | |
− | + | * molecular weight: | |
− | + | ** 453.471 | |
− | | | + | * inchi key: |
− | | | + | ** InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K |
− | }} | + | * common name: |
+ | ** phytyl diphosphate | ||
+ | * Synonym(s): | ||
+ | ** phytyl pyrophosphate | ||
+ | ** phytyl-PP | ||
+ | |||
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7674]] | ||
+ | * [[RXN-2541]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10625]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-7660]] | ||
+ | * [[RXN1F-66]] | ||
+ | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75434 75434] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728454 71728454] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05427 C05427] | ||
+ | {{#set: smiles=CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} | ||
+ | {{#set: molecular weight=453.471 }} | ||
+ | {{#set: inchi key=InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K}} | ||
+ | {{#set: common name=phytyl diphosphate}} | ||
+ | {{#set: common name=phytyl pyrophosphate|phytyl-PP}} | ||
+ | {{#set: consumed by=RXN-7674|RXN-2541}} | ||
+ | {{#set: produced by=RXN-10625}} | ||
+ | {{#set: reversible reaction associated=RXN-7660|RXN1F-66}} |
Latest revision as of 19:05, 9 January 2019
Contents
Metabolite PHYTYL-PYROPHOSPHATE
- smiles:
- CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- molecular weight:
- 453.471
- inchi key:
- InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K
- common name:
- phytyl diphosphate
- Synonym(s):
- phytyl pyrophosphate
- phytyl-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.