Difference between revisions of "RXN-1124"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5101 PWY-5101] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183924 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF 5-METHYL-THF] == * smiles: ** CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF 5-METHYL-THF] == |
− | * | + | * smiles: |
− | ** [ | + | ** CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=3)) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** L- | + | ** N5-methyl-tetrahydropteroyl mono-L-glutamate |
+ | * inchi key: | ||
+ | ** InChIKey=ZNOVTXRBGFNYRX-STQMWFEESA-L | ||
+ | * molecular weight: | ||
+ | ** 457.445 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-methyl-tetrahydrofolate mono-L-glutamate | ||
+ | ** 5-methyl-THF mono-L-glutamate | ||
+ | ** 5-methyl-5,6,7,8-tetrahydrofolate mono-L-glutamate | ||
+ | ** n5-methyltetrahydrofolate mono-L-glutamate | ||
+ | ** N5-methyl-THF mono-L-glutamate | ||
+ | ** methyl-THF mono-L-glutamate | ||
+ | ** methyl-tetrahydrofolate mono-L-glutamate | ||
+ | ** methyl-H4F mono-L-glutamate | ||
+ | ** 5-methyl-5,6,7,8-tetrahydropteroyl-L-glutamate | ||
+ | ** N5-methyl--H4PteGlu1 | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 134-35-0 | |
− | {{#set: | + | * BIGG : 5mthf |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=42626431 42626431] |
− | {{#set: | + | * HMDB : HMDB01396 |
− | {{#set: common name=L- | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00440 C00440] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.143.html 143] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18608 18608] | ||
+ | * METABOLIGHTS : MTBLC18608 | ||
+ | {{#set: smiles=CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=3))}} | ||
+ | {{#set: common name=N5-methyl-tetrahydropteroyl mono-L-glutamate}} | ||
+ | {{#set: inchi key=InChIKey=ZNOVTXRBGFNYRX-STQMWFEESA-L}} | ||
+ | {{#set: molecular weight=457.445 }} | ||
+ | {{#set: common name=5-methyl-tetrahydrofolate mono-L-glutamate|5-methyl-THF mono-L-glutamate|5-methyl-5,6,7,8-tetrahydrofolate mono-L-glutamate|n5-methyltetrahydrofolate mono-L-glutamate|N5-methyl-THF mono-L-glutamate|methyl-THF mono-L-glutamate|methyl-tetrahydrofolate mono-L-glutamate|methyl-H4F mono-L-glutamate|5-methyl-5,6,7,8-tetrahydropteroyl-L-glutamate|N5-methyl--H4PteGlu1}} | ||
+ | {{#set: consumed by=HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.}} | ||
+ | {{#set: produced by=1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.}} |
Revision as of 10:46, 18 January 2018
Contents
Metabolite 5-METHYL-THF
- smiles:
- CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=3))
- common name:
- N5-methyl-tetrahydropteroyl mono-L-glutamate
- inchi key:
- InChIKey=ZNOVTXRBGFNYRX-STQMWFEESA-L
- molecular weight:
- 457.445
- Synonym(s):
- 5-methyl-tetrahydrofolate mono-L-glutamate
- 5-methyl-THF mono-L-glutamate
- 5-methyl-5,6,7,8-tetrahydrofolate mono-L-glutamate
- n5-methyltetrahydrofolate mono-L-glutamate
- N5-methyl-THF mono-L-glutamate
- methyl-THF mono-L-glutamate
- methyl-tetrahydrofolate mono-L-glutamate
- methyl-H4F mono-L-glutamate
- 5-methyl-5,6,7,8-tetrahydropteroyl-L-glutamate
- N5-methyl--H4PteGlu1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 134-35-0
- BIGG : 5mthf
- PUBCHEM:
- HMDB : HMDB01396
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18608
"CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=3))" cannot be used as a page name in this wiki.