Difference between revisions of "PWY66-3"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7241 PWY-7241] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(CC[N+]CCCCC[N+])[N+] |
| + | * inchi key: | ||
| + | ** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q | ||
* common name: | * common name: | ||
| − | ** | + | ** aminopropylcadaverine |
| + | * molecular weight: | ||
| + | ** 162.298 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** N-3-aminopropyl-1,5-diaminopentane | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN0-5217]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565] | ||
| + | * HMDB : HMDB12189 | ||
| + | {{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}} | ||
| + | {{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}} | ||
| + | {{#set: common name=aminopropylcadaverine}} | ||
| + | {{#set: molecular weight=162.298 }} | ||
| + | {{#set: common name=N-3-aminopropyl-1,5-diaminopentane}} | ||
| + | {{#set: produced by=RXN0-5217}} | ||
Revision as of 11:47, 18 January 2018
Contents
Metabolite CPD0-1065
- smiles:
- C(CC[N+]CCCCC[N+])[N+]
- inchi key:
- InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
- common name:
- aminopropylcadaverine
- molecular weight:
- 162.298
- Synonym(s):
- N-3-aminopropyl-1,5-diaminopentane
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC[N+]CCCCC[N+])[N+" cannot be used as a page name in this wiki.
