Difference between revisions of "CHC T00006845001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12195 RXN-12195] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12195 RXN-12195] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.15 EC-3.6.1.15] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[CTP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[CDP]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 CTP[c] '''=>''' 1 phosphate[c] '''+''' 1 CDP[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00001236001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7184]], pyrimidine deoxyribonucleotides de novo biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7184 PWY-7184] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7198]], pyrimidine deoxyribonucleotides de novo biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7198 PWY-7198] | ||
+ | ** '''6''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-6545]], pyrimidine deoxyribonucleotides de novo biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6545 PWY-6545] | ||
+ | ** '''8''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7210]], pyrimidine deoxyribonucleotides biosynthesis from CTP: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7210 PWY-7210] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00569 R00569] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: ec number=EC-3.6.1.15}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=CHC_T00001236001_1}} |
− | + | {{#set: in pathway=PWY-7184|PWY-7198|PWY-6545|PWY-7210}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=galdieria.sulphuraria}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:48, 18 January 2018
Contents
Reaction RXN-12195
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 CTP[c] => 1 phosphate[c] + 1 CDP[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-7184, pyrimidine deoxyribonucleotides de novo biosynthesis I: PWY-7184
- 9 reactions found over 9 reactions in the full pathway
- PWY-7198, pyrimidine deoxyribonucleotides de novo biosynthesis IV: PWY-7198
- 6 reactions found over 7 reactions in the full pathway
- PWY-6545, pyrimidine deoxyribonucleotides de novo biosynthesis III: PWY-6545
- 8 reactions found over 9 reactions in the full pathway
- PWY-7210, pyrimidine deoxyribonucleotides biosynthesis from CTP: PWY-7210
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
External links
- LIGAND-RXN: