Difference between revisions of "Octadec-2-enoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == |
* smiles: | * smiles: | ||
| − | ** C(C([O-])=O | + | ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L |
* common name: | * common name: | ||
| − | ** | + | ** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 285.193 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** C1-(3-Indolyl)-glycerol 3-phosphate |
| − | ** | + | ** indole-3-glycerol-P |
| + | ** 1-(indol-3-yl)glycerol-3-P | ||
| + | ** 1-(indol-3-yl)glycerol-3-phosphate | ||
| + | ** indoleglycerol phosphate | ||
| + | ** indole-3-glycerol-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TRYPSYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[IGPSYN-RXN]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN0-2381]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866] |
| − | * | + | * BIGG : 3ig3p |
| − | {{#set: smiles=C(C([O-])=O | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506] |
| − | {{#set: common name= | + | {{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}} |
| − | {{#set: common name= | + | {{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=285.193 }} |
| − | {{#set: produced by= | + | {{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}} |
| + | {{#set: consumed by=TRYPSYN-RXN}} | ||
| + | {{#set: produced by=IGPSYN-RXN}} | ||
| + | {{#set: consumed or produced by=RXN0-2381}} | ||
Revision as of 10:49, 18 January 2018
Contents
Metabolite INDOLE-3-GLYCEROL-P
- smiles:
- C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
- inchi key:
- InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
- common name:
- (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
- molecular weight:
- 285.193
- Synonym(s):
- C1-(3-Indolyl)-glycerol 3-phosphate
- indole-3-glycerol-P
- 1-(indol-3-yl)glycerol-3-P
- 1-(indol-3-yl)glycerol-3-phosphate
- indoleglycerol phosphate
- indole-3-glycerol-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)" cannot be used as a page name in this wiki.
