Difference between revisions of "CYS-GLY"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5022 PWY-5022] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4575 CPD-4575] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4575 CPD-4575] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34)))) |
| + | * inchi key: | ||
| + | ** InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N | ||
* common name: | * common name: | ||
| − | ** 4- | + | ** 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol |
| + | * molecular weight: | ||
| + | ** 428.697 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN66-311]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN66-310]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name=4- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298936 22298936] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87289 87289] |
| − | {{#set: | + | * HMDB : HMDB12170 |
| + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N}} | ||
| + | {{#set: common name=4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol}} | ||
| + | {{#set: molecular weight=428.697 }} | ||
| + | {{#set: consumed by=RXN66-311}} | ||
| + | {{#set: produced by=RXN66-310}} | ||
Revision as of 10:49, 18 January 2018
Contents
Metabolite CPD-4575
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N
- common name:
- 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol
- molecular weight:
- 428.697
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
