Difference between revisions of "Methyl-Jasmonates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9661 RXN-9661] == * direction: ** LEFT-TO-RIGHT * common name: ** trans dodec-2-enoyl-[acp] red...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9661 RXN-9661] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
 +
* inchi key:
 +
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
 
* common name:
 
* common name:
−
** trans dodec-2-enoyl-[acp] reductase
+
** β-D-glucose 6-phosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-glucose-6-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-579]]
−
** 1 [[Dodec-2-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Dodecanoyl-ACPs]][c]
+
* [[BIOMASS-RXN]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 a (2E)-dodec-2-enoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a dodecanoyl-[acp][c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-16996]]
−
== Genes associated with this reaction  ==
+
* [[BETA-PHOSPHOGLUCOMUTASE-RXN]]
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009325001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans dodec-2-enoyl-[acp] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
−
{{#set: ec number=EC-1.3.1.9}}
+
* HMDB : HMDB03498
−
{{#set: gene associated=CHC_T00009325001_1}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-5971}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
−
{{#set: reconstruction category=orthology}}
+
* CHEMSPIDER:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
 +
* BIGG : g6p
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
 +
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
 +
{{#set: common name=β-D-glucose 6-phosphate}}
 +
{{#set: molecular weight=258.121    }}
 +
{{#set: common name=β-D-glucose-6-P}}
 +
{{#set: consumed by=RXN66-579|BIOMASS-RXN}}
 +
{{#set: consumed or produced by=RXN-16996|BETA-PHOSPHOGLUCOMUTASE-RXN}}

Revision as of 10:50, 18 January 2018

Metabolite GLC-6-P

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
  • inchi key:
    • InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
  • common name:
    • β-D-glucose 6-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • β-D-glucose-6-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Methyl-Jasmonates&oldid=4970"