Difference between revisions of "ASPARTATE-DEG1-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7791 PWY-7791] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7791 PWY-7791] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
* common name: | * common name: | ||
− | ** | + | ** UMP biosynthesis III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** uridine-5'-phosphate biosynthesis III |
+ | ** de novo biosynthesis of uridine-5'-phosphate III | ||
+ | ** de novo biosynthesis of uridine-5'-monophosphate III | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''5''' reaction(s) found |
− | * [[ | + | ** [[CARBPSYN-RXN]] |
− | == Reaction(s) | + | ** [[OROPRIBTRANS-RXN]] |
− | + | ** [[OROTPDECARB-RXN]] | |
− | * [ | + | ** [[ASPCARBTRANS-RXN]] |
− | + | ** [[DIHYDROOROT-RXN]] | |
+ | == Reaction(s) not found == | ||
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=OROTATE-REDUCTASE-NADH-RXN OROTATE-REDUCTASE-NADH-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-201174}} | |
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=UMP biosynthesis III}} | |
− | + | {{#set: common name=uridine-5'-phosphate biosynthesis III|de novo biosynthesis of uridine-5'-phosphate III|de novo biosynthesis of uridine-5'-monophosphate III}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 10:50, 18 January 2018
Pathway PWY-7791
- taxonomic range:
- common name:
- UMP biosynthesis III
- Synonym(s):
- uridine-5'-phosphate biosynthesis III
- de novo biosynthesis of uridine-5'-phosphate III
- de novo biosynthesis of uridine-5'-monophosphate III
Reaction(s) found
- 5 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found