Difference between revisions of "PWY-7492"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5424 RXN-5424] == * direction: ** LEFT-TO-RIGHT * common name: ** indole-3-glycol dehydrogenase...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5424 RXN-5424] ==
* smiles:
+
* direction:
** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
+
 
* common name:
 
* common name:
** FAD
+
** indole-3-glycol dehydrogenase
* molecular weight:
+
* ec number:
** 782.533   
+
** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1]
 
* Synonym(s):
 
* Synonym(s):
** flavin adenine dinucleotide oxidized
 
** flavin adenine dinucleotide
 
** flavitan
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[FADSYN-RXN]]
+
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[3-INDOLYLGLYCOLALDEHYDE]][c] '''=>''' 1 [[INDOLE-3-GLYCOL]][c] '''+''' 1 [[NAD]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[RXN-14264]]
+
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 indole-3-glycol aldehyde[c] '''=>''' 1 indole-3-glycol[c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00010066001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-3162]], L-tryptophan degradation V (side chain pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3162 PWY-3162]
 +
** '''2''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
* CAS : 146-14-5
+
{{#set: direction=LEFT-TO-RIGHT}}
* Wikipedia : Flavin_adenine_dinucleotide
+
{{#set: common name=indole-3-glycol dehydrogenase}}
* PUBCHEM:
+
{{#set: ec number=EC-1.1.1.1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035]
+
{{#set: gene associated=CHC_T00010066001_1}}
* HMDB : HMDB01248
+
{{#set: in pathway=PWY-3162}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016]
+
{{#set: reconstruction tool=pantograph}}
* CHEMSPIDER:
+
{{#set: reconstruction source=galdieria.sulphuraria}}
** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692]
+
* BIGG : fad
+
{{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}}
+
{{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}}
+
{{#set: common name=FAD}}
+
{{#set: molecular weight=782.533    }}
+
{{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}}
+
{{#set: produced by=FADSYN-RXN}}
+
{{#set: consumed or produced by=RXN-14264}}
+

Revision as of 10:50, 18 January 2018

Reaction RXN-5424

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • indole-3-glycol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3162, L-tryptophan degradation V (side chain pathway): PWY-3162
    • 2 reactions found over 13 reactions in the full pathway

Reconstruction information

External links