Difference between revisions of "RXN-3661"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5424 RXN-5424] == * direction: ** LEFT-TO-RIGHT * common name: ** indole-3-glycol dehydrogenase...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5424 RXN-5424] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(CC(=O)C(=O)[O-])CC(=O)[O-]
 +
* inchi key:
 +
** InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** indole-3-glycol dehydrogenase
+
** 2-oxoadipate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1]
+
** 158.11   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-ketoadipate
 +
** α-ketoadipate
 +
** 2-keto-adipate
 +
** 2-oxohexanedionic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[3-INDOLYLGLYCOLALDEHYDE]][c] '''=>''' 1 [[INDOLE-3-GLYCOL]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 indole-3-glycol aldehyde[c] '''=>''' 1 indole-3-glycol[c] '''+''' 1 NAD+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00010066001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-3162]], L-tryptophan degradation V (side chain pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3162 PWY-3162]
+
−
** '''2''' reactions found over '''13''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 3184-35-8
−
{{#set: common name=indole-3-glycol dehydrogenase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.1.1.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615192 23615192]
−
{{#set: gene associated=CHC_T00010066001_1}}
+
* HMDB : HMDB00225
−
{{#set: in pathway=PWY-3162}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00322 C00322]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
** [http://www.chemspider.com/Chemical-Structure.19951093.html 19951093]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57499 57499]
 +
* METABOLIGHTS : MTBLC57499
 +
{{#set: smiles=C(CC(=O)C(=O)[O-])CC(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L}}
 +
{{#set: common name=2-oxoadipate}}
 +
{{#set: molecular weight=158.11    }}
 +
{{#set: common name=2-ketoadipate|α-ketoadipate|2-keto-adipate|2-oxohexanedionic acid}}
 +
{{#set: consumed by=2-KETO-ADIPATE-DEHYDROG-RXN}}

Revision as of 10:50, 18 January 2018

Metabolite 2K-ADIPATE

  • smiles:
    • C(CC(=O)C(=O)[O-])CC(=O)[O-]
  • inchi key:
    • InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L
  • common name:
    • 2-oxoadipate
  • molecular weight:
    • 158.11
  • Synonym(s):
    • 2-ketoadipate
    • α-ketoadipate
    • 2-keto-adipate
    • 2-oxohexanedionic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC(=O)C(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-3661&oldid=5058"