Difference between revisions of "3.5.1.26-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == * smiles: ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Gene == Gene CHC_T00008907001 == * left end position: ** 142378 * transcription direction: ** NEGATIVE * right end position: ** 143739 * centisome position: ** 70...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
+
== Gene CHC_T00008907001 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 142378
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (2E,11Z)-octadecenoyl-CoA
+
** 143739
−
* molecular weight:
+
* centisome position:
−
** 1025.937    
+
** 70.11898    
 
* Synonym(s):
 
* Synonym(s):
−
** 18:2-Δ2,Δ11-CoA
 
−
** 2-trans,11-cis-octadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17785]]
+
* [[2.7.7.14-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** original_genome
−
* [[RXN-17784]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7782]]
 +
* [[PWY4FS-6]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=142378}}
−
{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
+
{{#set: right end position=143739}}
−
{{#set: molecular weight=1025.937   }}
+
{{#set: centisome position=70.11898   }}
−
{{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
+
{{#set: reaction associated=2.7.7.14-RXN}}
−
{{#set: consumed by=RXN-17785}}
+
{{#set: pathway associated=PWY-7782|PWY4FS-6}}
−
{{#set: produced by=RXN-17784}}
+

Revision as of 11:52, 18 January 2018

Gene CHC_T00008907001

  • left end position:
    • 142378
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 143739
  • centisome position:
    • 70.11898
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=3.5.1.26-RXN&oldid=5262"