Difference between revisions of "PHOSPHATIDYL-MYO-INOSITOL-45-BISPHOSPHA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-ETCETERA-LIPOPOLYSACCHARIDE N-ACETYL-ETCETERA-LIPOPOLYSACCHARIDE] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC SUC] == * smiles: ** C(C([O-])=O)CC([O-])=O * inchi key: ** InChIKey=KDYFGRWQOYBRFD-UHFFFAO...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC SUC] == |
+ | * smiles: | ||
+ | ** C(C([O-])=O)CC([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=KDYFGRWQOYBRFD-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** succinate |
+ | * molecular weight: | ||
+ | ** 116.073 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** succinic acid | ||
+ | ** suc | ||
+ | ** succ | ||
+ | ** butanedioic acid | ||
+ | ** ethylenesuccinic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ExchangeDeadEnd_SUC]] | ||
+ | * [[RXN-15378]] | ||
+ | * [[RXN-14971]] | ||
+ | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[SUCCSEMIALDDEHYDROG-RXN]] |
+ | * [[METBALT-RXN]] | ||
+ | * [[BIOMASS-RXN]] | ||
+ | * [[ExchangeDeadEnd_SUC]] | ||
+ | * [[RXN0-5245]] | ||
+ | * [[RXN0-5293]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
+ | * [[RXN-9384]] | ||
+ | * [[SUCCCOASYN-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 110-15-6 |
− | {{#set: produced by= | + | * METABOLIGHTS : MTBLC30031 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160419 160419] | ||
+ | * KNAPSACK : C00001205 | ||
+ | * HMDB : HMDB00254 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00042 C00042] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.140973.html 140973] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30031 30031] | ||
+ | * BIGG : succ | ||
+ | {{#set: smiles=C(C([O-])=O)CC([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=KDYFGRWQOYBRFD-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=succinate}} | ||
+ | {{#set: molecular weight=116.073 }} | ||
+ | {{#set: common name=succinic acid|suc|succ|butanedioic acid|ethylenesuccinic acid}} | ||
+ | {{#set: consumed by=ExchangeDeadEnd_SUC|RXN-15378|RXN-14971|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN}} | ||
+ | {{#set: produced by=SUCCSEMIALDDEHYDROG-RXN|METBALT-RXN|BIOMASS-RXN|ExchangeDeadEnd_SUC|RXN0-5245|RXN0-5293}} | ||
+ | {{#set: consumed or produced by=O-SUCCHOMOSERLYASE-RXN|RXN-9384|SUCCCOASYN-RXN}} |
Revision as of 10:53, 18 January 2018
Contents
Metabolite SUC
- smiles:
- C(C([O-])=O)CC([O-])=O
- inchi key:
- InChIKey=KDYFGRWQOYBRFD-UHFFFAOYSA-L
- common name:
- succinate
- molecular weight:
- 116.073
- Synonym(s):
- succinic acid
- suc
- succ
- butanedioic acid
- ethylenesuccinic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 110-15-6
- METABOLIGHTS : MTBLC30031
- PUBCHEM:
- KNAPSACK : C00001205
- HMDB : HMDB00254
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : succ
"C(C([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.