Difference between revisions of "CHC T00009104001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R621-RXN R621-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R621-RXN R621-RXN] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
+
** [http://enzyme.expasy.org/EC/1.14.12.17 EC-1.14.12.17]
−
* common name:
+
−
** 7-dehydrodesmosterol
+
−
* molecular weight:
+
−
** 382.628   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5α-cholesta-5,7,24-trien-3β-ol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11887]]
+
** 2 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 2 [[NITRIC-OXIDE]][c] '''=>''' 2 [[NITRATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NAD-P-OR-NOP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 oxygen[c] '''+''' 1 NAD(P)H[c] '''+''' 2 nitric oxide[c] '''=>''' 2 nitrate[c] '''+''' 1 H+[c] '''+''' 1 NAD(P)+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00008774001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00006886001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440558 440558]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05724 R05724]
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R05725 R05725]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.14.12.17}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107]
+
{{#set: gene associated=CHC_T00008774001_1|CHC_T00006886001_1}}
−
* HMDB : HMDB03896
+
{{#set: in pathway=}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=7-dehydrodesmosterol}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
−
{{#set: molecular weight=382.628    }}
+
−
{{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}}
+
−
{{#set: produced by=RXN-11887}}
+

Revision as of 11:56, 18 January 2018

Reaction R621-RXN

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009104001_1&oldid=5566"