Difference between revisions of "CPD-18550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...")
 
(Created page with "Category:Gene == Gene CHC_T00010264001_1 == * Synonym(s): == Reactions associated == * RXN-11109 ** pantograph-galdieria.sulphuraria == Pathways associated ==...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Gene CHC_T00010264001_1 ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
* common name:
+
** protochlorophyllide a
+
* molecular weight:
+
** 610.951   
+
 
* Synonym(s):
 
* Synonym(s):
** monovinyl protochlorophyllide a
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN-11109]]
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[galdieria.sulphuraria]]
* [[RXN1F-10]]
+
== Pathways associated ==
* [[RXN1F-72]]
+
 
== External links  ==
 
== External links  ==
* CAS : 14751-08-7
+
{{#set: reaction associated=RXN-11109}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
+
* HMDB : HMDB31148
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=protochlorophyllide a}}
+
{{#set: molecular weight=610.951    }}
+
{{#set: common name=monovinyl protochlorophyllide a}}
+
{{#set: consumed or produced by=RXN1F-10|RXN1F-72}}
+

Revision as of 11:56, 18 January 2018

Gene CHC_T00010264001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links