Difference between revisions of "CHC T00008996001 1"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009130001 == * left end position: ** 586597 * transcription direction: ** POSITIVE * right end position: ** 588237 * centisome position: ** 89...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] == * smiles: ** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J |
− | * | + | * common name: |
− | ** | + | ** 3-oxo-(5Z)-tetradecenoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 985.829 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxo-5-cis-tetradecenoyl-CoA | ||
+ | ** 3-oxo-14:1-Δ5-CoA | ||
+ | ** 3-keto-5-cis-tetradecenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-14394]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659295 90659295] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87707 87707] |
− | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
+ | {{#set: inchi key=InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J}} | ||
+ | {{#set: common name=3-oxo-(5Z)-tetradecenoyl-CoA}} | ||
+ | {{#set: molecular weight=985.829 }} | ||
+ | {{#set: common name=3-oxo-5-cis-tetradecenoyl-CoA|3-oxo-14:1-Δ5-CoA|3-keto-5-cis-tetradecenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-14394}} |
Revision as of 11:57, 18 January 2018
Contents
Metabolite CPD-15244
- smiles:
- CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J
- common name:
- 3-oxo-(5Z)-tetradecenoyl-CoA
- molecular weight:
- 985.829
- Synonym(s):
- 3-oxo-5-cis-tetradecenoyl-CoA
- 3-oxo-14:1-Δ5-CoA
- 3-keto-5-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.