Difference between revisions of "P3-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-DEHYDROG-RXN ALCOHOL-DEHYDROG-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://en...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-DEHYDROG-RXN ALCOHOL-DEHYDROG-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1]
+
** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
 +
* common name:
 +
** 5-hydroxyindole acetate
 +
* molecular weight:
 +
** 190.178   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxyindoleacetic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NAD]][c] '''+''' 1 [[ETOH]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ACETALD]][c]
+
* [[RXN-10780]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD+[c] '''+''' 1 ethanol[c] '''<=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 acetaldehyde[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00010066001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY66-21]], ethanol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-21 PWY66-21]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY4LZ-257]], superpathway of fermentation (Chlamydomonas reinhardtii): [http://metacyc.org/META/NEW-IMAGE?object=PWY4LZ-257 PWY4LZ-257]
+
−
** '''6''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PWY-7118]], chitin degradation to ethanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
* [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
+
−
** '''11''' reactions found over '''16''' reactions in the full pathway
+
−
* [[PWY-6333]], acetaldehyde biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWY-5486]], pyruvate fermentation to ethanol II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5486 PWY-5486]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[P161-PWY]], acetylene degradation: [http://metacyc.org/META/NEW-IMAGE?object=P161-PWY P161-PWY]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[ETOH-ACETYLCOA-ANA-PWY]], ethanol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=ETOH-ACETYLCOA-ANA-PWY ETOH-ACETYLCOA-ANA-PWY]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
+
−
** '''15''' reactions found over '''18''' reactions in the full pathway
+
−
* [[PWY-5480]], pyruvate fermentation to ethanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5480 PWY-5480]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6587]], pyruvate fermentation to ethanol III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6587 PWY-6587]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 54-16-0
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25290 25290]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00754 R00754]
+
* HMDB : HMDB00763
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.1.1.1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635]
−
{{#set: gene associated=CHC_T00010066001_1}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY66-21|PWY4LZ-257|PWY-7118|FERMENTATION-PWY|PWY-6333|PWY-5486|P161-PWY|ETOH-ACETYLCOA-ANA-PWY|P122-PWY|PWY-5480|PWY-6587}}
+
** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}}
 +
{{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}}
 +
{{#set: common name=5-hydroxyindole acetate}}
 +
{{#set: molecular weight=190.178    }}
 +
{{#set: common name=5-hydroxyindoleacetic acid}}
 +
{{#set: produced by=RXN-10780}}

Revision as of 11:59, 18 January 2018

Metabolite 5-HYDROXYINDOLE_ACETATE

  • smiles:
    • C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
  • inchi key:
    • InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
  • common name:
    • 5-hydroxyindole acetate
  • molecular weight:
    • 190.178
  • Synonym(s):
    • 5-hydroxyindoleacetic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=P3-PWY&oldid=5787"