Difference between revisions of "CPD-3483"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N3-methyluracil1498 16S-rRNA-N3-methyluracil1498] == * common name: ** an N3-methylura...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N3-methyluracil1498 16S-rRNA-N3-methyluracil1498] ==
* smiles:
+
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
+
 
* common name:
 
* common name:
** 6-trans-tridecenoyl-CoA
+
** an N3-methyluracil1498 in 16S rRNA
* molecular weight:
+
** 957.819   
+
 
* Synonym(s):
 
* Synonym(s):
** 6E-tridecenoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14785]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11598]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N3-methyluracil1498 in 16S rRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572]
+
{{#set: produced by=RXN-11598}}
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}}
+
{{#set: common name=6-trans-tridecenoyl-CoA}}
+
{{#set: molecular weight=957.819    }}
+
{{#set: common name=6E-tridecenoyl-CoA}}
+
{{#set: consumed by=RXN-14785}}
+

Revision as of 12:00, 18 January 2018

Metabolite 16S-rRNA-N3-methyluracil1498

  • common name:
    • an N3-methyluracil1498 in 16S rRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links